C8H13NO3S — CID 11009022
methyl (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 11009022) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is methyl (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11009022 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | methyl (4R)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CSC(C)(C)N1C=O |
| InChI | InChI=1S/C8H13NO3S/c1-8(2)9(5-10)6(4-13-8)7(11)12-3/h5-6H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | UFNGRIIHGPLSPT-LURJTMIESA-N |
| XLogP | 0.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|