C8H16Cl2N2 — CID 11009217
1-butyl-3-methyl-1H-imidazole-1,3-diium dichloride (PubChem CID 11009217) has the molecular formula C8H16Cl2N2 and a molecular weight of 211.14 g/mol. Its IUPAC name is 1-butyl-3-methyl-1H-imidazole-1,3-diium dichloride.
| Compound Name | 1-butyl-3-methyl-1H-imidazole-1,3-diium dichloride |
|---|---|
| PubChem CID | 11009217 |
| Molecular Formula | C8H16Cl2N2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-butyl-3-methyl-1H-imidazole-1,3-diium dichloride |
| SMILES | CCCC[NH+]1C=C[N+](C)=C1.[Cl-].[Cl-] |
| InChI | InChI=1S/C8H15N2.2ClH/c1-3-4-5-10-7-6-9(2)8-10;;/h6-8H,3-5H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | APTQQPURCVDTGV-UHFFFAOYSA-M |
| XLogP | -6.17 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | -6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|