C9H13BrO — CID 11009383
(1S)-1-bromo-3,4-dimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 11009383) has the molecular formula C9H13BrO and a molecular weight of 217.11 g/mol. Its IUPAC name is (1S)-1-bromo-3,4-dimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1S)-1-bromo-3,4-dimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 11009383 |
| Molecular Formula | C9H13BrO |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (1S)-1-bromo-3,4-dimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CC1=C(C)C[C@](Br)(C=O)CC1 |
| InChI | InChI=1S/C9H13BrO/c1-7-3-4-9(10,6-11)5-8(7)2/h6H,3-5H2,1-2H3/t9-/m0/s1 |
| InChIKey | UMIHCTLDYFFUAB-VIFPVBQESA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|