C16H24O3 — CID 101428496
(1-formyl-3,4-dimethylcyclohex-3-en-1-yl) cyclohexanecarboxylate (PubChem CID 101428496) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1-formyl-3,4-dimethylcyclohex-3-en-1-yl) cyclohexanecarboxylate.
| Compound Name | (1-formyl-3,4-dimethylcyclohex-3-en-1-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 101428496 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1-formyl-3,4-dimethylcyclohex-3-en-1-yl) cyclohexanecarboxylate |
| SMILES | CC1=C(C)CC(C=O)(OC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H24O3/c1-12-8-9-16(11-17,10-13(12)2)19-15(18)14-6-4-3-5-7-14/h11,14H,3-10H2,1-2H3 |
| InChIKey | UGLYUFOANZEJQF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|