2,2-diformylcyclohexane-1-carboxylic acid

C9H12O4 — CID 87124247

IUPAC2,2-diformylcyclohexane-1-carboxylic acid
SMILESO=CC1(C=O)CCCCC1C(=O)O
InChIInChI=1S/C9H12O4/c10-5-9(6-11)4-2-1-3-7(9)8(12)13/h5-7H,1-4H2,(H,12,13)
InChIKeyDTSJIIAGJPTHMD-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.65
Rot. Bonds3

About 2,2-diformylcyclohexane-1-carboxylic acid

2,2-diformylcyclohexane-1-carboxylic acid (PubChem CID 87124247) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2,2-diformylcyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name2,2-diformylcyclohexane-1-carboxylic acid
PubChem CID87124247
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Name2,2-diformylcyclohexane-1-carboxylic acid
SMILESO=CC1(C=O)CCCCC1C(=O)O
InChIInChI=1S/C9H12O4/c10-5-9(6-11)4-2-1-3-7(9)8(12)13/h5-7H,1-4H2,(H,12,13)
InChIKeyDTSJIIAGJPTHMD-UHFFFAOYSA-N
XLogP0.65
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2,2-diformylcyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

spiro[5.6]dodecane-12-carboxylic acid
CID 59513338
spiro[3.4]octane-8-carboxylic acid
CID 83905140
(1R)-2,2-difluorocycloheptane-1-carboxylic acid
CID 97297799
1-ethenylcyclohexane-1,2-dicarboxylic acid
CID 156868252
trans-(1S,2S)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylic acid
CID 102532516
methane;1-methylcyclohexane-1,2-dicarboxylic acid
CID 173225702
1-methylcyclohexane-1,2-dicarboxylic acid;hydrochloride
CID 159985709
1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid
CID 67543785
1,4-dioxaspiro[4.6]undecane-6-carboxylic acid
CID 131629776
benzene;1-cyclohexylcyclohexane-1,2-dicarboxylic acid
CID 174291946
cis-(1R,2R)-2-bromo-2-(4-bromophenyl)cyclohexane-1-carboxylic acid
CID 134892462
1-aminocyclopentane-1,2-dicarboxylic acid;azane
CID 54610731

Frequently Asked Questions

What is the IUPAC name of 2,2-diformylcyclohexane-1-carboxylic acid?
The IUPAC name of 2,2-diformylcyclohexane-1-carboxylic acid (CID 87124247) is 2,2-diformylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 2,2-diformylcyclohexane-1-carboxylic acid?
The canonical SMILES for 2,2-diformylcyclohexane-1-carboxylic acid is O=CC1(C=O)CCCCC1C(=O)O.
What is the InChIKey of 2,2-diformylcyclohexane-1-carboxylic acid?
The InChIKey is DTSJIIAGJPTHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c10-5-9(6-11)4-2-1-3-7(9)8(12)13/h5-7H,1-4H2,(H,12,13).
What are the key properties of 2,2-diformylcyclohexane-1-carboxylic acid?
2,2-diformylcyclohexane-1-carboxylic acid has a molecular weight of 184.19 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diformylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 87124247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).