C16H18O3 — CID 132549778
[(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] benzoate (PubChem CID 132549778) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is [(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] benzoate.
| Compound Name | [(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] benzoate |
|---|---|
| PubChem CID | 132549778 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] benzoate |
| SMILES | CC1=C(C)C[C@@](C=O)(OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H18O3/c1-12-8-9-16(11-17,10-13(12)2)19-15(18)14-6-4-3-5-7-14/h3-7,11H,8-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | DXYKFTKKNCATRM-INIZCTEOSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|