C25H38O4Si — CID 135054543
[(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] 4-tri(propan-2-yl)silyloxybenzoate (PubChem CID 135054543) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is [(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] 4-tri(propan-2-yl)silyloxybenzoate.
| Compound Name | [(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] 4-tri(propan-2-yl)silyloxybenzoate |
|---|---|
| PubChem CID | 135054543 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [(1S)-1-formyl-3,4-dimethylcyclohex-3-en-1-yl] 4-tri(propan-2-yl)silyloxybenzoate |
| SMILES | CC1=C(C)C[C@@](C=O)(OC(=O)c2ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H38O4Si/c1-17(2)30(18(3)4,19(5)6)29-23-11-9-22(10-12-23)24(27)28-25(16-26)14-13-20(7)21(8)15-25/h9-12,16-19H,13-15H2,1-8H3/t25-/m0/s1 |
| InChIKey | MBFDBLKIABLGJC-VWLOTQADSA-N |
| XLogP | 6.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|