C20H33NO4Si — CID 154307074
[4-oxo-3-[4-tri(propan-2-yl)silyloxyphenyl]butyl]carbamic acid (PubChem CID 154307074) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is [4-oxo-3-[4-tri(propan-2-yl)silyloxyphenyl]butyl]carbamic acid.
| Compound Name | [4-oxo-3-[4-tri(propan-2-yl)silyloxyphenyl]butyl]carbamic acid |
|---|---|
| PubChem CID | 154307074 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | [4-oxo-3-[4-tri(propan-2-yl)silyloxyphenyl]butyl]carbamic acid |
| SMILES | CC(C)[Si](Oc1ccc(C(C=O)CCNC(=O)O)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33NO4Si/c1-14(2)26(15(3)4,16(5)6)25-19-9-7-17(8-10-19)18(13-22)11-12-21-20(23)24/h7-10,13-16,18,21H,11-12H2,1-6H3,(H,23,24) |
| InChIKey | HMJDIIZQJBEBFB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|