C24H41NO5Si — CID 59804670
2-methyl-6-[[4-tri(propan-2-yl)silyloxyphenyl]methoxycarbonylamino]hexanoic acid (PubChem CID 59804670) has the molecular formula C24H41NO5Si and a molecular weight of 451.68 g/mol. Its IUPAC name is 2-methyl-6-[[4-tri(propan-2-yl)silyloxyphenyl]methoxycarbonylamino]hexanoic acid.
| Compound Name | 2-methyl-6-[[4-tri(propan-2-yl)silyloxyphenyl]methoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 59804670 |
| Molecular Formula | C24H41NO5Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 2-methyl-6-[[4-tri(propan-2-yl)silyloxyphenyl]methoxycarbonylamino]hexanoic acid |
| SMILES | CC(CCCCNC(=O)OCc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C24H41NO5Si/c1-17(2)31(18(3)4,19(5)6)30-22-13-11-21(12-14-22)16-29-24(28)25-15-9-8-10-20(7)23(26)27/h11-14,17-20H,8-10,15-16H2,1-7H3,(H,25,28)(H,26,27) |
| InChIKey | SHAHEIDMIQQFNM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|