C26H42FNO8Si — CID 142687783
(2E)-2-[(3-fluoro-4-methoxyphenyl)methylidene]-8-(3-triethoxysilylpropylcarbamoyloxy)octanoic acid (PubChem CID 142687783) has the molecular formula C26H42FNO8Si and a molecular weight of 543.71 g/mol. Its IUPAC name is (2E)-2-[(3-fluoro-4-methoxyphenyl)methylidene]-8-(3-triethoxysilylpropylcarbamoyloxy)octanoic acid.
| Compound Name | (2E)-2-[(3-fluoro-4-methoxyphenyl)methylidene]-8-(3-triethoxysilylpropylcarbamoyloxy)octanoic acid |
|---|---|
| PubChem CID | 142687783 |
| Molecular Formula | C26H42FNO8Si |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | (2E)-2-[(3-fluoro-4-methoxyphenyl)methylidene]-8-(3-triethoxysilylpropylcarbamoyloxy)octanoic acid |
| SMILES | CCO[Si](CCCNC(=O)OCCCCCC/C(=C\c1ccc(OC)c(F)c1)C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C26H42FNO8Si/c1-5-34-37(35-6-2,36-7-3)18-12-16-28-26(31)33-17-11-9-8-10-13-22(25(29)30)19-21-14-15-24(32-4)23(27)20-21/h14-15,19-20H,5-13,16-18H2,1-4H3,(H,28,31)(H,29,30)/b22-19+ |
| InChIKey | IJTODSSVSVYMPY-ZBJSNUHESA-N |
| XLogP | 5.42 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|