C19H33NO3Si — CID 91749323
2-methylpropyl N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]carbamate (PubChem CID 91749323) has the molecular formula C19H33NO3Si and a molecular weight of 351.56 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 91749323 |
| Molecular Formula | C19H33NO3Si |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-methylpropyl N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]carbamate |
| SMILES | CC(C)COC(=O)NCCc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H33NO3Si/c1-15(2)14-22-18(21)20-13-12-16-8-10-17(11-9-16)23-24(6,7)19(3,4)5/h8-11,15H,12-14H2,1-7H3,(H,20,21) |
| InChIKey | KGEHPSQBYAFMLB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|