C22H41NO3Si2 — CID 91743545
N-[2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]acetamide (PubChem CID 91743545) has the molecular formula C22H41NO3Si2 and a molecular weight of 423.75 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]acetamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 91743545 |
| Molecular Formula | C22H41NO3Si2 |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]acetamide |
| SMILES | CC(=O)NCC(O[Si](C)(C)C(C)(C)C)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H41NO3Si2/c1-17(24)23-16-20(26-28(10,11)22(5,6)7)18-12-14-19(15-13-18)25-27(8,9)21(2,3)4/h12-15,20H,16H2,1-11H3,(H,23,24) |
| InChIKey | IJYHLLWRPYQFJG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|