C20H34F3NO3Si2 — CID 6428500
N-butyl-2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(4-trimethylsilyloxyphenyl)ethyl]acetamide (PubChem CID 6428500) has the molecular formula C20H34F3NO3Si2 and a molecular weight of 449.66 g/mol. Its IUPAC name is N-butyl-2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(4-trimethylsilyloxyphenyl)ethyl]acetamide.
| Compound Name | N-butyl-2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(4-trimethylsilyloxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 6428500 |
| Molecular Formula | C20H34F3NO3Si2 |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-butyl-2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(4-trimethylsilyloxyphenyl)ethyl]acetamide |
| SMILES | CCCCN(CC(O[Si](C)(C)C)c1ccc(O[Si](C)(C)C)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H34F3NO3Si2/c1-8-9-14-24(19(25)20(21,22)23)15-18(27-29(5,6)7)16-10-12-17(13-11-16)26-28(2,3)4/h10-13,18H,8-9,14-15H2,1-7H3 |
| InChIKey | ZKNLSNZOBYTSPM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|