C22H36F7NO4Si3 — CID 6427695
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide (PubChem CID 6427695) has the molecular formula C22H36F7NO4Si3 and a molecular weight of 595.78 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
|---|---|
| PubChem CID | 6427695 |
| Molecular Formula | C22H36F7NO4Si3 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
| SMILES | CN(CC(O[Si](C)(C)C)c1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H36F7NO4Si3/c1-30(19(31)20(23,24)21(25,26)22(27,28)29)14-18(34-37(8,9)10)15-11-12-16(32-35(2,3)4)17(13-15)33-36(5,6)7/h11-13,18H,14H2,1-10H3 |
| InChIKey | YGLMMYJNTVLKEX-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|