C21H36F3NO5Si3 — CID 6427697
trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[methyl-(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 6427697) has the molecular formula C21H36F3NO5Si3 and a molecular weight of 523.77 g/mol. Its IUPAC name is trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[methyl-(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[methyl-(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 6427697 |
| Molecular Formula | C21H36F3NO5Si3 |
| Molecular Weight | 523.77 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[methyl-(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CN(C(=O)C(F)(F)F)C(Cc1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H36F3NO5Si3/c1-25(20(27)21(22,23)24)16(19(26)30-33(8,9)10)13-15-11-12-17(28-31(2,3)4)18(14-15)29-32(5,6)7/h11-12,14,16H,13H2,1-10H3 |
| InChIKey | YHZNNDRWAXPVGP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.77 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|