C20H36F3NO4Si3 — CID 553891
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 553891) has the molecular formula C20H36F3NO4Si3 and a molecular weight of 495.76 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 553891 |
| Molecular Formula | C20H36F3NO4Si3 |
| Molecular Weight | 495.76 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(CC(O[Si](C)(C)C)c1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H36F3NO4Si3/c1-24(19(25)20(21,22)23)14-18(28-31(8,9)10)15-11-12-16(26-29(2,3)4)17(13-15)27-30(5,6)7/h11-13,18H,14H2,1-10H3 |
| InChIKey | SXAPUNOGPVDUQY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|