C21H34F7NO4Si3 — CID 6427698
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 6427698) has the molecular formula C21H34F7NO4Si3 and a molecular weight of 581.75 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 6427698 |
| Molecular Formula | C21H34F7NO4Si3 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | C[Si](C)(C)Oc1ccc(C(CNC(=O)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C21H34F7NO4Si3/c1-34(2,3)31-15-11-10-14(12-16(15)32-35(4,5)6)17(33-36(7,8)9)13-29-18(30)19(22,23)20(24,25)21(26,27)28/h10-12,17H,13H2,1-9H3,(H,29,30) |
| InChIKey | FEABORWAPKZVDG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|