C26H37F6NO4Si3 — CID 528735
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 528735) has the molecular formula C26H37F6NO4Si3 and a molecular weight of 625.83 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 528735 |
| Molecular Formula | C26H37F6NO4Si3 |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C[Si](C)(C)Oc1ccc(C(CNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)O[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C26H37F6NO4Si3/c1-38(2,3)35-21-11-10-17(14-22(21)36-39(4,5)6)23(37-40(7,8)9)16-33-24(34)18-12-19(25(27,28)29)15-20(13-18)26(30,31)32/h10-15,23H,16H2,1-9H3,(H,33,34) |
| InChIKey | RAMMWEIIFWOGPV-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|