C24H31F6NO3Si2 — CID 526015
N-methyl-3,5-bis(trifluoromethyl)-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]benzamide (PubChem CID 526015) has the molecular formula C24H31F6NO3Si2 and a molecular weight of 551.68 g/mol. Its IUPAC name is N-methyl-3,5-bis(trifluoromethyl)-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]benzamide.
| Compound Name | N-methyl-3,5-bis(trifluoromethyl)-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 526015 |
| Molecular Formula | C24H31F6NO3Si2 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | N-methyl-3,5-bis(trifluoromethyl)-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]benzamide |
| SMILES | CN(CC(O[Si](C)(C)C)c1cccc(O[Si](C)(C)C)c1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H31F6NO3Si2/c1-31(22(32)17-11-18(23(25,26)27)14-19(12-17)24(28,29)30)15-21(34-36(5,6)7)16-9-8-10-20(13-16)33-35(2,3)4/h8-14,21H,15H2,1-7H3 |
| InChIKey | YNNAAKHUVJFAQK-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|