C19H34F3NO4Si3 — CID 553889
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoroacetamide (PubChem CID 553889) has the molecular formula C19H34F3NO4Si3 and a molecular weight of 481.74 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 553889 |
| Molecular Formula | C19H34F3NO4Si3 |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoroacetamide |
| SMILES | C[Si](C)(C)Oc1ccc(C(CNC(=O)C(F)(F)F)O[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C19H34F3NO4Si3/c1-28(2,3)25-15-11-10-14(12-16(15)26-29(4,5)6)17(27-30(7,8)9)13-23-18(24)19(20,21)22/h10-12,17H,13H2,1-9H3,(H,23,24) |
| InChIKey | CRFVINPEQAEMIM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|