C20H34F3NO5Si3 — CID 622431
trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 622431) has the molecular formula C20H34F3NO5Si3 and a molecular weight of 509.75 g/mol. Its IUPAC name is trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 622431 |
| Molecular Formula | C20H34F3NO5Si3 |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | trimethylsilyl 3-[3,4-bis(trimethylsilyloxy)phenyl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | C[Si](C)(C)OC(=O)C(Cc1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H34F3NO5Si3/c1-30(2,3)27-16-11-10-14(13-17(16)28-31(4,5)6)12-15(18(25)29-32(7,8)9)24-19(26)20(21,22)23/h10-11,13,15H,12H2,1-9H3,(H,24,26) |
| InChIKey | OGIZXHXABNSGRO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|