C19H34F3NO3Si3 — CID 553660
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide (PubChem CID 553660) has the molecular formula C19H34F3NO3Si3 and a molecular weight of 465.74 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide |
|---|---|
| PubChem CID | 553660 |
| Molecular Formula | C19H34F3NO3Si3 |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide |
| SMILES | C[Si](C)(C)Oc1ccc(CCN(C(=O)C(F)(F)F)[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C19H34F3NO3Si3/c1-27(2,3)23(18(24)19(20,21)22)13-12-15-10-11-16(25-28(4,5)6)17(14-15)26-29(7,8)9/h10-11,14H,12-13H2,1-9H3 |
| InChIKey | NBZNPWGIGWZDSI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|