C29H44F3NO4Si2 — CID 10579178
N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide (PubChem CID 10579178) has the molecular formula C29H44F3NO4Si2 and a molecular weight of 583.84 g/mol. Its IUPAC name is N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide.
| Compound Name | N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 10579178 |
| Molecular Formula | C29H44F3NO4Si2 |
| Molecular Weight | 583.84 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | N-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CN(CCc2ccc(O)cc2)C(=O)C(F)(F)F)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H44F3NO4Si2/c1-27(2,3)38(7,8)36-24-16-13-22(19-25(24)37-39(9,10)28(4,5)6)20-33(26(35)29(30,31)32)18-17-21-11-14-23(34)15-12-21/h11-16,19,34H,17-18,20H2,1-10H3 |
| InChIKey | RDJBGMLUCYIZBN-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.84 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|