C29H42F3NO4Si2 — CID 10507489
7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 10507489) has the molecular formula C29H42F3NO4Si2 and a molecular weight of 581.82 g/mol. Its IUPAC name is 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 10507489 |
| Molecular Formula | C29H42F3NO4Si2 |
| Molecular Weight | 581.82 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc2c(cc1O[Si](C)(C)C(C)(C)C)C1(C=CC(=O)C=C1)CCN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C29H42F3NO4Si2/c1-26(2,3)38(7,8)36-23-17-20-19-33(25(35)29(30,31)32)16-15-28(13-11-21(34)12-14-28)22(20)18-24(23)37-39(9,10)27(4,5)6/h11-14,17-18H,15-16,19H2,1-10H3 |
| InChIKey | SAHVWWXKAFSBOA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.82 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|