C15H22F3NO2Si — CID 529772
2,2,2-trifluoro-N-methyl-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide (PubChem CID 529772) has the molecular formula C15H22F3NO2Si and a molecular weight of 333.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 529772 |
| Molecular Formula | C15H22F3NO2Si |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
| SMILES | CC(Cc1ccc(O[Si](C)(C)C)cc1)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H22F3NO2Si/c1-11(19(2)14(20)15(16,17)18)10-12-6-8-13(9-7-12)21-22(3,4)5/h6-9,11H,10H2,1-5H3 |
| InChIKey | BXTHWTVTDNVFJY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|