C21H25ClF3NO2Si — CID 91747733
N-[(2-chlorophenyl)methyl]-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide (PubChem CID 91747733) has the molecular formula C21H25ClF3NO2Si and a molecular weight of 443.97 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 91747733 |
| Molecular Formula | C21H25ClF3NO2Si |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
| SMILES | CC(Cc1ccc(O[Si](C)(C)C)cc1)N(Cc1ccccc1Cl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H25ClF3NO2Si/c1-15(13-16-9-11-18(12-10-16)28-29(2,3)4)26(20(27)21(23,24)25)14-17-7-5-6-8-19(17)22/h5-12,15H,13-14H2,1-4H3 |
| InChIKey | XAILHBBALWXBCG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|