C21H26F3NO2Si — CID 91753852
2,2,2-trifluoro-N-(1-phenylpropan-2-yl)-N-[(2-trimethylsilyloxyphenyl)methyl]acetamide (PubChem CID 91753852) has the molecular formula C21H26F3NO2Si and a molecular weight of 409.52 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1-phenylpropan-2-yl)-N-[(2-trimethylsilyloxyphenyl)methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1-phenylpropan-2-yl)-N-[(2-trimethylsilyloxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 91753852 |
| Molecular Formula | C21H26F3NO2Si |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2,2,2-trifluoro-N-(1-phenylpropan-2-yl)-N-[(2-trimethylsilyloxyphenyl)methyl]acetamide |
| SMILES | CC(Cc1ccccc1)N(Cc1ccccc1O[Si](C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H26F3NO2Si/c1-16(14-17-10-6-5-7-11-17)25(20(26)21(22,23)24)15-18-12-8-9-13-19(18)27-28(2,3)4/h5-13,16H,14-15H2,1-4H3 |
| InChIKey | JCQRWPCCNCUYMF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|