C18H27ClF3NO2Si — CID 91753856
N-(4-chlorobutyl)-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide (PubChem CID 91753856) has the molecular formula C18H27ClF3NO2Si and a molecular weight of 409.95 g/mol. Its IUPAC name is N-(4-chlorobutyl)-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide.
| Compound Name | N-(4-chlorobutyl)-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 91753856 |
| Molecular Formula | C18H27ClF3NO2Si |
| Molecular Weight | 409.95 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(4-chlorobutyl)-2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
| SMILES | CC(Cc1ccc(O[Si](C)(C)C)cc1)N(CCCCCl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H27ClF3NO2Si/c1-14(23(12-6-5-11-19)17(24)18(20,21)22)13-15-7-9-16(10-8-15)25-26(2,3)4/h7-10,14H,5-6,11-13H2,1-4H3 |
| InChIKey | KPLVESRMOBLKEH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.95 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|