C18H30F3NO3Si2 — CID 91753853
2,2,2-trifluoro-N-methyl-N-[1-trimethylsilyloxy-1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide (PubChem CID 91753853) has the molecular formula C18H30F3NO3Si2 and a molecular weight of 421.61 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[1-trimethylsilyloxy-1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[1-trimethylsilyloxy-1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 91753853 |
| Molecular Formula | C18H30F3NO3Si2 |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[1-trimethylsilyloxy-1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
| SMILES | CC(C(O[Si](C)(C)C)c1ccc(O[Si](C)(C)C)cc1)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H30F3NO3Si2/c1-13(22(2)17(23)18(19,20)21)16(25-27(6,7)8)14-9-11-15(12-10-14)24-26(3,4)5/h9-13,16H,1-8H3 |
| InChIKey | PCZKUFGOSJMQTK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|