C16H26F3NO3Si2 — CID 6428507
2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]acetamide (PubChem CID 6428507) has the molecular formula C16H26F3NO3Si2 and a molecular weight of 393.55 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 6428507 |
| Molecular Formula | C16H26F3NO3Si2 |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-trimethylsilyloxy-2-(3-trimethylsilyloxyphenyl)ethyl]acetamide |
| SMILES | C[Si](C)(C)Oc1cccc(C(CNC(=O)C(F)(F)F)O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C16H26F3NO3Si2/c1-24(2,3)22-13-9-7-8-12(10-13)14(23-25(4,5)6)11-20-15(21)16(17,18)19/h7-10,14H,11H2,1-6H3,(H,20,21) |
| InChIKey | UMNIDXSISGUGLI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|