C14H20F3NO2Si — CID 134871977
2,2,2-trifluoro-N-[(1R,2S)-1-phenyl-1-trimethylsilyloxypropan-2-yl]acetamide (PubChem CID 134871977) has the molecular formula C14H20F3NO2Si and a molecular weight of 319.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2S)-1-phenyl-1-trimethylsilyloxypropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2S)-1-phenyl-1-trimethylsilyloxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 134871977 |
| Molecular Formula | C14H20F3NO2Si |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2S)-1-phenyl-1-trimethylsilyloxypropan-2-yl]acetamide |
| SMILES | C[C@H](NC(=O)C(F)(F)F)[C@H](O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H20F3NO2Si/c1-10(18-13(19)14(15,16)17)12(20-21(2,3)4)11-8-6-5-7-9-11/h5-10,12H,1-4H3,(H,18,19)/t10-,12-/m0/s1 |
| InChIKey | JFKPUFHQKOLHQD-JQWIXIFHSA-N |
| XLogP | 3.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|