C13H18F3NO2Si — CID 6428499
2,2,2-trifluoro-N-(2-phenyl-2-trimethylsilyloxyethyl)acetamide (PubChem CID 6428499) has the molecular formula C13H18F3NO2Si and a molecular weight of 305.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-phenyl-2-trimethylsilyloxyethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-phenyl-2-trimethylsilyloxyethyl)acetamide |
|---|---|
| PubChem CID | 6428499 |
| Molecular Formula | C13H18F3NO2Si |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-phenyl-2-trimethylsilyloxyethyl)acetamide |
| SMILES | C[Si](C)(C)OC(CNC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H18F3NO2Si/c1-20(2,3)19-11(10-7-5-4-6-8-10)9-17-12(18)13(14,15)16/h4-8,11H,9H2,1-3H3,(H,17,18) |
| InChIKey | AJLWQAOZKRRGQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|