C14H20F3NO2Si — CID 6428504
2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide (PubChem CID 6428504) has the molecular formula C14H20F3NO2Si and a molecular weight of 319.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 6428504 |
| Molecular Formula | C14H20F3NO2Si |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(4-trimethylsilyloxyphenyl)propan-2-yl]acetamide |
| SMILES | CC(Cc1ccc(O[Si](C)(C)C)cc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2Si/c1-10(18-13(19)14(15,16)17)9-11-5-7-12(8-6-11)20-21(2,3)4/h5-8,10H,9H2,1-4H3,(H,18,19) |
| InChIKey | XQJOUOPKHMJJLA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|