C18H28F3NO5Si2 — CID 610540
trimethylsilyl 3-(3-methoxy-4-trimethylsilyloxyphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 610540) has the molecular formula C18H28F3NO5Si2 and a molecular weight of 451.59 g/mol. Its IUPAC name is trimethylsilyl 3-(3-methoxy-4-trimethylsilyloxyphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | trimethylsilyl 3-(3-methoxy-4-trimethylsilyloxyphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 610540 |
| Molecular Formula | C18H28F3NO5Si2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | trimethylsilyl 3-(3-methoxy-4-trimethylsilyloxyphenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COc1cc(CC(NC(=O)C(F)(F)F)C(=O)O[Si](C)(C)C)ccc1O[Si](C)(C)C |
| InChI | InChI=1S/C18H28F3NO5Si2/c1-25-15-11-12(8-9-14(15)26-28(2,3)4)10-13(16(23)27-29(5,6)7)22-17(24)18(19,20)21/h8-9,11,13H,10H2,1-7H3,(H,22,24) |
| InChIKey | WVVPADUULXLVJX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|