C22H42F3NO4Si4 — CID 553890
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide (PubChem CID 553890) has the molecular formula C22H42F3NO4Si4 and a molecular weight of 553.92 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide |
|---|---|
| PubChem CID | 553890 |
| Molecular Formula | C22H42F3NO4Si4 |
| Molecular Weight | 553.92 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-2,2,2-trifluoro-N-trimethylsilylacetamide |
| SMILES | C[Si](C)(C)Oc1ccc(C(CN(C(=O)C(F)(F)F)[Si](C)(C)C)O[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C22H42F3NO4Si4/c1-31(2,3)26(21(27)22(23,24)25)16-20(30-34(10,11)12)17-13-14-18(28-32(4,5)6)19(15-17)29-33(7,8)9/h13-15,20H,16H2,1-12H3 |
| InChIKey | JUWADJGDSYFFCZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.92 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|