About N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide
N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 110095106) has the molecular formula C15H19N5OS
and a molecular weight of 317.42 g/mol. Its IUPAC name is N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 110095106 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1cnc(C2CCCCN2c2ncccn2)s1 |
| InChI | InChI=1S/C15H19N5OS/c1-19(2)14(21)12-10-18-13(22-12)11-6-3-4-9-20(11)15-16-7-5-8-17-15/h5,7-8,10-11H,3-4,6,9H2,1-2H3 |
| InChIKey | RCGILNZLVOOBAW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide (CID 110095106) is N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide is CN(C)C(=O)c1cnc(C2CCCCN2c2ncccn2)s1.
What is the InChIKey of N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide?
The InChIKey is RCGILNZLVOOBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5OS/c1-19(2)14(21)12-10-18-13(22-12)11-6-3-4-9-20(11)15-16-7-5-8-17-15/h5,7-8,10-11H,3-4,6,9H2,1-2H3.
What are the key properties of N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide?
N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide has a molecular weight of 317.42 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(1-pyrimidin-2-ylpiperidin-2-yl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 110095106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).