About 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide
2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide (PubChem CID 125008264) has the molecular formula C15H23N3O2S
and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 125008264 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1cnc([C@H]2CCCCN2C(=O)C(C)(C)C)s1 |
| InChI | InChI=1S/C15H23N3O2S/c1-15(2,3)14(20)18-8-6-5-7-10(18)13-17-9-11(21-13)12(19)16-4/h9-10H,5-8H2,1-4H3,(H,16,19)/t10-/m1/s1 |
| InChIKey | UTRMYXFMNCVJDM-SNVBAGLBSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide (CID 125008264) is 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide is CNC(=O)c1cnc([C@H]2CCCCN2C(=O)C(C)(C)C)s1.
What is the InChIKey of 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is UTRMYXFMNCVJDM-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H23N3O2S/c1-15(2,3)14(20)18-8-6-5-7-10(18)13-17-9-11(21-13)12(19)16-4/h9-10H,5-8H2,1-4H3,(H,16,19)/t10-/m1/s1.
What are the key properties of 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide?
2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 309.44 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-1-(2,2-dimethylpropanoyl)piperidin-2-yl]-N-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 125008264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).