C17H23NO3 — CID 110096890
2-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetic acid (PubChem CID 110096890) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 2-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetic acid.
| Compound Name | 2-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 110096890 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetic acid |
| SMILES | COc1cccc(C[C@H]2CC[C@@H]3CN(CC(=O)O)C[C@H]23)c1 |
| InChI | InChI=1S/C17H23NO3/c1-21-15-4-2-3-12(8-15)7-13-5-6-14-9-18(10-16(13)14)11-17(19)20/h2-4,8,13-14,16H,5-7,9-11H2,1H3,(H,19,20)/t13-,14-,16-/m1/s1 |
| InChIKey | BPOHRCBAAKSXEK-IIAWOOMASA-N |
| XLogP | 2.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |