C29H36N2O3 — CID 110138771
[4-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpiperidin-1-yl]-phenylmethanone (PubChem CID 110138771) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is [4-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpiperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpiperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110138771 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | [4-[(3aR,4R,6aS)-4-[(3-methoxyphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-methylpiperidin-1-yl]-phenylmethanone |
| SMILES | COc1cccc(C[C@H]2CC[C@@H]3CN(C(=O)C4(C)CCN(C(=O)c5ccccc5)CC4)C[C@H]23)c1 |
| InChI | InChI=1S/C29H36N2O3/c1-29(13-15-30(16-14-29)27(32)22-8-4-3-5-9-22)28(33)31-19-24-12-11-23(26(24)20-31)17-21-7-6-10-25(18-21)34-2/h3-10,18,23-24,26H,11-17,19-20H2,1-2H3/t23-,24-,26-/m1/s1 |
| InChIKey | IDAMAUIDXLHNOS-DGWZTRNLSA-N |
| XLogP | 4.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |