C13H17N3O2S — CID 110100064
5-(1-methylsulfonylpiperidin-3-yl)imidazo[1,2-a]pyridine (PubChem CID 110100064) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-(1-methylsulfonylpiperidin-3-yl)imidazo[1,2-a]pyridine.
| Compound Name | 5-(1-methylsulfonylpiperidin-3-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 110100064 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-(1-methylsulfonylpiperidin-3-yl)imidazo[1,2-a]pyridine |
| SMILES | CS(=O)(=O)N1CCCC(c2cccc3nccn23)C1 |
| InChI | InChI=1S/C13H17N3O2S/c1-19(17,18)15-8-3-4-11(10-15)12-5-2-6-13-14-7-9-16(12)13/h2,5-7,9,11H,3-4,8,10H2,1H3 |
| InChIKey | WRRWTRIALGBCSA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |