C6H5Cl2F5 — CID 11010150
(Z)-1,5-dichloro-1,1,2,2,3-pentafluorohex-3-ene (PubChem CID 11010150) has the molecular formula C6H5Cl2F5 and a molecular weight of 243.00 g/mol. Its IUPAC name is (Z)-1,5-dichloro-1,1,2,2,3-pentafluorohex-3-ene.
| Compound Name | (Z)-1,5-dichloro-1,1,2,2,3-pentafluorohex-3-ene |
|---|---|
| PubChem CID | 11010150 |
| Molecular Formula | C6H5Cl2F5 |
| Molecular Weight | 243.00 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | (Z)-1,5-dichloro-1,1,2,2,3-pentafluorohex-3-ene |
| SMILES | CC(Cl)/C=C(\F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C6H5Cl2F5/c1-3(7)2-4(9)5(10,11)6(8,12)13/h2-3H,1H3/b4-2- |
| InChIKey | QWKPUGQUWKBGJP-RQOWECAXSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.00 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|