C14H19FeN+2 — CID 11010616
alpha-(N,N-Dimethylamino)ethylferrocene (PubChem CID 11010616) has the molecular formula C14H19FeN+2 and a molecular weight of 257.16 g/mol.
| Compound Name | alpha-(N,N-Dimethylamino)ethylferrocene |
|---|---|
| PubChem CID | 11010616 |
| Molecular Formula | C14H19FeN+2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | — |
| SMILES | CC(C1=CC=C[CH]1)N(C)C.[CH]1C=CC=C1.[Fe+2] |
| InChI | InChI=1S/C9H14N.C5H5.Fe/c1-8(10(2)3)9-6-4-5-7-9;1-2-4-5-3-1;/h4-8H,1-3H3;1-5H;/q;;+2 |
| InChIKey | GBUQFTGXDHYCCG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|