C17H20N2O — CID 11011008
(E)-3-methyl-2-(2,2,6-trimethyl-3-oxoindol-1-yl)pent-2-enenitrile (PubChem CID 11011008) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (E)-3-methyl-2-(2,2,6-trimethyl-3-oxoindol-1-yl)pent-2-enenitrile.
| Compound Name | (E)-3-methyl-2-(2,2,6-trimethyl-3-oxoindol-1-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 11011008 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (E)-3-methyl-2-(2,2,6-trimethyl-3-oxoindol-1-yl)pent-2-enenitrile |
| SMILES | CC/C(C)=C(\C#N)N1c2cc(C)ccc2C(=O)C1(C)C |
| InChI | InChI=1S/C17H20N2O/c1-6-12(3)15(10-18)19-14-9-11(2)7-8-13(14)16(20)17(19,4)5/h7-9H,6H2,1-5H3/b15-12+ |
| InChIKey | BTCWCKPOJUNZEG-NTCAYCPXSA-N |
| XLogP | 3.98 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|