C19H23N5O2 — CID 110113017
3-[4-[(5-methoxy-1H-indol-2-yl)methyl]morpholin-2-yl]-N-methylpyrazin-2-amine (PubChem CID 110113017) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 3-[4-[(5-methoxy-1H-indol-2-yl)methyl]morpholin-2-yl]-N-methylpyrazin-2-amine.
| Compound Name | 3-[4-[(5-methoxy-1H-indol-2-yl)methyl]morpholin-2-yl]-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 110113017 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[4-[(5-methoxy-1H-indol-2-yl)methyl]morpholin-2-yl]-N-methylpyrazin-2-amine |
| SMILES | CNc1nccnc1C1CN(Cc2cc3cc(OC)ccc3[nH]2)CCO1 |
| InChI | InChI=1S/C19H23N5O2/c1-20-19-18(21-5-6-22-19)17-12-24(7-8-26-17)11-14-9-13-10-15(25-2)3-4-16(13)23-14/h3-6,9-10,17,23H,7-8,11-12H2,1-2H3,(H,20,22) |
| InChIKey | KCYMGHNEBWRNQZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |