About tetrapropylphosphanium bromide
tetrapropylphosphanium bromide (PubChem CID 11011483) has the molecular formula C12H28BrP
and a molecular weight of 283.23 g/mol. Its IUPAC name is tetrapropylphosphanium bromide.
Molecular Properties
| Compound Name | tetrapropylphosphanium bromide |
| PubChem CID | 11011483 |
| Molecular Formula | C12H28BrP |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | tetrapropylphosphanium bromide |
| SMILES | CCC[P+](CCC)(CCC)CCC.[Br-] |
| InChI | InChI=1S/C12H28P.BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SMGSPBKMKYMJPQ-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylphosphanium bromide?
The IUPAC name of tetrapropylphosphanium bromide (CID 11011483) is tetrapropylphosphanium bromide.
What is the SMILES notation for tetrapropylphosphanium bromide?
The canonical SMILES for tetrapropylphosphanium bromide is CCC[P+](CCC)(CCC)CCC.[Br-].
What is the InChIKey of tetrapropylphosphanium bromide?
The InChIKey is SMGSPBKMKYMJPQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28P.BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of tetrapropylphosphanium bromide?
tetrapropylphosphanium bromide has a molecular weight of 283.23 g/mol, XLogP of 1.65, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylphosphanium bromide is sourced from PubChem (CID 11011483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).