About tetrapropylphosphanium fluoride
tetrapropylphosphanium fluoride (PubChem CID 23053641) has the molecular formula C12H28FP
and a molecular weight of 222.33 g/mol. Its IUPAC name is tetrapropylphosphanium fluoride.
Molecular Properties
| Compound Name | tetrapropylphosphanium fluoride |
| PubChem CID | 23053641 |
| Molecular Formula | C12H28FP |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | tetrapropylphosphanium fluoride |
| SMILES | CCC[P+](CCC)(CCC)CCC.[F-] |
| InChI | InChI=1S/C12H28P.FH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RWBCVBNFUZGZHX-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylphosphanium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylphosphanium fluoride?
The IUPAC name of tetrapropylphosphanium fluoride (CID 23053641) is tetrapropylphosphanium fluoride.
What is the SMILES notation for tetrapropylphosphanium fluoride?
The canonical SMILES for tetrapropylphosphanium fluoride is CCC[P+](CCC)(CCC)CCC.[F-].
What is the InChIKey of tetrapropylphosphanium fluoride?
The InChIKey is RWBCVBNFUZGZHX-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28P.FH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of tetrapropylphosphanium fluoride?
tetrapropylphosphanium fluoride has a molecular weight of 222.33 g/mol, XLogP of 1.65, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylphosphanium fluoride is sourced from PubChem (CID 23053641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).