tetrapropylphosphanium fluoride

C12H28FP — CID 23053641

IUPACtetrapropylphosphanium fluoride
SMILESCCC[P+](CCC)(CCC)CCC.[F-]
InChIInChI=1S/C12H28P.FH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1
InChIKeyRWBCVBNFUZGZHX-UHFFFAOYSA-M
MW222.33 g/mol
LogP1.65
Rot. Bonds8

About tetrapropylphosphanium fluoride

tetrapropylphosphanium fluoride (PubChem CID 23053641) has the molecular formula C12H28FP and a molecular weight of 222.33 g/mol. Its IUPAC name is tetrapropylphosphanium fluoride.

Molecular Properties

Compound Nametetrapropylphosphanium fluoride
PubChem CID23053641
Molecular FormulaC12H28FP
Molecular Weight222.33 g/mol
Exact Mass222.19
IUPAC Nametetrapropylphosphanium fluoride
SMILESCCC[P+](CCC)(CCC)CCC.[F-]
InChIInChI=1S/C12H28P.FH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1
InChIKeyRWBCVBNFUZGZHX-UHFFFAOYSA-M
XLogP1.65
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.33
LogP ≤ 51.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze tetrapropylphosphanium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tetrapropylphosphanium fluoride?
The IUPAC name of tetrapropylphosphanium fluoride (CID 23053641) is tetrapropylphosphanium fluoride.
What is the SMILES notation for tetrapropylphosphanium fluoride?
The canonical SMILES for tetrapropylphosphanium fluoride is CCC[P+](CCC)(CCC)CCC.[F-].
What is the InChIKey of tetrapropylphosphanium fluoride?
The InChIKey is RWBCVBNFUZGZHX-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28P.FH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of tetrapropylphosphanium fluoride?
tetrapropylphosphanium fluoride has a molecular weight of 222.33 g/mol, XLogP of 1.65, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylphosphanium fluoride is sourced from PubChem (CID 23053641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).