About boranuide;tetrapropylphosphanium
boranuide;tetrapropylphosphanium (PubChem CID 14746814) has the molecular formula C12H32BP
and a molecular weight of 218.17 g/mol. Its IUPAC name is boranuide;tetrapropylphosphanium.
Molecular Properties
| Compound Name | boranuide;tetrapropylphosphanium |
| PubChem CID | 14746814 |
| Molecular Formula | C12H32BP |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.23 |
| IUPAC Name | boranuide;tetrapropylphosphanium |
| SMILES | CCC[P+](CCC)(CCC)CCC.[BH4-] |
| InChI | InChI=1S/C12H28P.BH4/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H4/q+1;-1 |
| InChIKey | LPOYZAZRDLVCHU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze boranuide;tetrapropylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boranuide;tetrapropylphosphanium?
The IUPAC name of boranuide;tetrapropylphosphanium (CID 14746814) is boranuide;tetrapropylphosphanium.
What is the SMILES notation for boranuide;tetrapropylphosphanium?
The canonical SMILES for boranuide;tetrapropylphosphanium is CCC[P+](CCC)(CCC)CCC.[BH4-].
What is the InChIKey of boranuide;tetrapropylphosphanium?
The InChIKey is LPOYZAZRDLVCHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28P.BH4/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H4/q+1;-1.
What are the key properties of boranuide;tetrapropylphosphanium?
boranuide;tetrapropylphosphanium has a molecular weight of 218.17 g/mol, XLogP of 3.19, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for boranuide;tetrapropylphosphanium is sourced from PubChem (CID 14746814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).