C19H23N3O4 — CID 110117732
2-(4-methoxyphenoxy)-N-[[2-(oxan-2-yl)pyrimidin-5-yl]methyl]acetamide (PubChem CID 110117732) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[[2-(oxan-2-yl)pyrimidin-5-yl]methyl]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[[2-(oxan-2-yl)pyrimidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 110117732 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[[2-(oxan-2-yl)pyrimidin-5-yl]methyl]acetamide |
| SMILES | COc1ccc(OCC(=O)NCc2cnc(C3CCCCO3)nc2)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-24-15-5-7-16(8-6-15)26-13-18(23)20-10-14-11-21-19(22-12-14)17-4-2-3-9-25-17/h5-8,11-12,17H,2-4,9-10,13H2,1H3,(H,20,23) |
| InChIKey | LXSFVULSILDGLS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |