C20H26N4O2 — CID 124945377
4-[(dimethylamino)methyl]-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]benzamide (PubChem CID 124945377) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]benzamide.
| Compound Name | 4-[(dimethylamino)methyl]-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 124945377 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]benzamide |
| SMILES | CN(C)Cc1ccc(C(=O)NCc2cnc([C@@H]3CCCCO3)nc2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-24(2)14-15-6-8-17(9-7-15)20(25)23-13-16-11-21-19(22-12-16)18-5-3-4-10-26-18/h6-9,11-12,18H,3-5,10,13-14H2,1-2H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | BQMZVELDFYSRBY-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |