C17H23N5O2 — CID 125024972
N-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]-1-propylpyrazole-3-carboxamide (PubChem CID 125024972) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]-1-propylpyrazole-3-carboxamide.
| Compound Name | N-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]-1-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 125024972 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]-1-propylpyrazole-3-carboxamide |
| SMILES | CCCn1ccc(C(=O)NCc2cnc([C@H]3CCCCO3)nc2)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-2-7-22-8-6-14(21-22)17(23)20-12-13-10-18-16(19-11-13)15-5-3-4-9-24-15/h6,8,10-11,15H,2-5,7,9,12H2,1H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | ZJIBAFTYZDIKLB-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |